C16H30N2O5+2 — CID 6985564
5,7-diethyl-2-[(1S,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 6985564) has the molecular formula C16H30N2O5+2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 5,7-diethyl-2-[(1S,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | 5,7-diethyl-2-[(1S,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 6985564 |
| Molecular Formula | C16H30N2O5+2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 5,7-diethyl-2-[(1S,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CCC12C[NH+]3CC(CC)(C[NH+](C1)C3[C@H](O)[C@H](O)[C@H](O)CO)C2=O |
| InChI | InChI=1S/C16H28N2O5/c1-3-15-6-17-8-16(4-2,14(15)23)9-18(7-15)13(17)12(22)11(21)10(20)5-19/h10-13,19-22H,3-9H2,1-2H3/p+2/t10-,11-,12-,13?,15?,16?/m1/s1 |
| InChIKey | DDFSYXNAYCTMRJ-RHTVDLJGSA-P |
| XLogP | -4.44 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |