C18H34N2O5+2 — CID 7203703
5,7-dipropyl-2-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 7203703) has the molecular formula C18H34N2O5+2 and a molecular weight of 358.48 g/mol. Its IUPAC name is 5,7-dipropyl-2-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | 5,7-dipropyl-2-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 7203703 |
| Molecular Formula | C18H34N2O5+2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 5,7-dipropyl-2-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CCCC12C[NH+]3CC(CCC)(C[NH+](C1)C3[C@@H](O)[C@H](O)[C@H](O)CO)C2=O |
| InChI | InChI=1S/C18H32N2O5/c1-3-5-17-8-19-10-18(6-4-2,16(17)25)11-20(9-17)15(19)14(24)13(23)12(22)7-21/h12-15,21-24H,3-11H2,1-2H3/p+2/t12-,13-,14+,15?,17?,18?/m1/s1 |
| InChIKey | DIUVTWMGTCXFNH-YIBCYSADSA-P |
| XLogP | -3.66 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |