C14H28N2O4+2 — CID 7083457
(1S,2R,3R)-1-(5,7-dimethyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-2-yl)butane-1,2,3,4-tetrol (PubChem CID 7083457) has the molecular formula C14H28N2O4+2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (1S,2R,3R)-1-(5,7-dimethyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-2-yl)butane-1,2,3,4-tetrol.
| Compound Name | (1S,2R,3R)-1-(5,7-dimethyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-2-yl)butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 7083457 |
| Molecular Formula | C14H28N2O4+2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | (1S,2R,3R)-1-(5,7-dimethyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-2-yl)butane-1,2,3,4-tetrol |
| SMILES | CC12C[NH+]3CC(C)(C[NH+](C1)C3[C@H](O)[C@@H](O)[C@H](O)CO)C2 |
| InChI | InChI=1S/C14H26N2O4/c1-13-4-14(2)7-15(5-13)12(16(6-13)8-14)11(20)10(19)9(18)3-17/h9-12,17-20H,3-8H2,1-2H3/p+2/t9-,10+,11-,12?,13?,14?/m1/s1 |
| InChIKey | YHVMNTQNLJRCTI-DTAYRBJGSA-P |
| XLogP | -4.40 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |