C15H28N2O6 — CID 7075395
(1R,2S,3R,4R)-1-(6-hydroxy-5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-2-yl)pentane-1,2,3,4,5-pentol (PubChem CID 7075395) has the molecular formula C15H28N2O6 and a molecular weight of 332.40 g/mol. Its IUPAC name is (1R,2S,3R,4R)-1-(6-hydroxy-5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-2-yl)pentane-1,2,3,4,5-pentol.
| Compound Name | (1R,2S,3R,4R)-1-(6-hydroxy-5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-2-yl)pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 7075395 |
| Molecular Formula | C15H28N2O6 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (1R,2S,3R,4R)-1-(6-hydroxy-5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-2-yl)pentane-1,2,3,4,5-pentol |
| SMILES | CC12CN3CC(C)(CN(C1)C3[C@@H](O)[C@H](O)[C@H](O)[C@H](O)CO)C2O |
| InChI | InChI=1S/C15H28N2O6/c1-14-4-16-6-15(2,13(14)23)7-17(5-14)12(16)11(22)10(21)9(20)8(19)3-18/h8-13,18-23H,3-7H2,1-2H3/t8-,9-,10-,11+,12?,13?,14?,15?/m1/s1 |
| InChIKey | SROWMOMOKMQMBI-VOUXDCKRSA-N |
| XLogP | -3.23 |
| TPSA | 127.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |