C14H24N4O8 — CID 3703963
1-(6,6-dimethyl-5,7-dinitro-1,3-diazatricyclo[3.3.1.13,7]decan-2-yl)butane-1,2,3,4-tetrol (PubChem CID 3703963) has the molecular formula C14H24N4O8 and a molecular weight of 376.37 g/mol. Its IUPAC name is 1-(6,6-dimethyl-5,7-dinitro-1,3-diazatricyclo[3.3.1.13,7]decan-2-yl)butane-1,2,3,4-tetrol.
| Compound Name | 1-(6,6-dimethyl-5,7-dinitro-1,3-diazatricyclo[3.3.1.13,7]decan-2-yl)butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 3703963 |
| Molecular Formula | C14H24N4O8 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-(6,6-dimethyl-5,7-dinitro-1,3-diazatricyclo[3.3.1.13,7]decan-2-yl)butane-1,2,3,4-tetrol |
| SMILES | CC1(C)C2([N+](=O)[O-])CN3CC1([N+](=O)[O-])CN(C2)C3C(O)C(O)C(O)CO |
| InChI | InChI=1S/C14H24N4O8/c1-12(2)13(17(23)24)4-15-6-14(12,18(25)26)7-16(5-13)11(15)10(22)9(21)8(20)3-19/h8-11,19-22H,3-7H2,1-2H3 |
| InChIKey | VKKHDSYXTBMPII-UHFFFAOYSA-N |
| XLogP | -2.91 |
| TPSA | 173.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|