C19H25N3O5 — CID 124726512
methyl (2S,3aR,7aR)-1-[4-(ethylamino)-3-nitrobenzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 124726512) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is methyl (2S,3aR,7aR)-1-[4-(ethylamino)-3-nitrobenzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl (2S,3aR,7aR)-1-[4-(ethylamino)-3-nitrobenzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 124726512 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | methyl (2S,3aR,7aR)-1-[4-(ethylamino)-3-nitrobenzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | CCNc1ccc(C(=O)N2[C@@H]3CCCC[C@@H]3C[C@H]2C(=O)OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H25N3O5/c1-3-20-14-9-8-13(11-16(14)22(25)26)18(23)21-15-7-5-4-6-12(15)10-17(21)19(24)27-2/h8-9,11-12,15,17,20H,3-7,10H2,1-2H3/t12-,15-,17+/m1/s1 |
| InChIKey | CCARUKSCKPYHRS-VMGRFDJRSA-N |
| XLogP | 2.97 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|