C22H34N4O3S — CID 124726657
1-[(3S,8aS)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 124726657) has the molecular formula C22H34N4O3S and a molecular weight of 434.61 g/mol. Its IUPAC name is 1-[(3S,8aS)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 1-[(3S,8aS)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 124726657 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 1-[(3S,8aS)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | CC[C@H]1CN2CCC[C@H]2CN1C(=O)CN1CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C22H34N4O3S/c1-3-19-15-24-10-4-5-20(24)16-26(19)22(27)17-23-11-13-25(14-12-23)30(28,29)21-8-6-18(2)7-9-21/h6-9,19-20H,3-5,10-17H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | CIFQGUKLIULJCB-PMACEKPBSA-N |
| XLogP | 1.39 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |