C22H33N3O3S — CID 55680227
N-cyclohexyl-N-cyclopropyl-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 55680227) has the molecular formula C22H33N3O3S and a molecular weight of 419.59 g/mol. Its IUPAC name is N-cyclohexyl-N-cyclopropyl-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-cyclohexyl-N-cyclopropyl-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55680227 |
| Molecular Formula | C22H33N3O3S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-cyclohexyl-N-cyclopropyl-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CC(=O)N(C3CCCCC3)C3CC3)CC2)cc1 |
| InChI | InChI=1S/C22H33N3O3S/c1-18-7-11-21(12-8-18)29(27,28)24-15-13-23(14-16-24)17-22(26)25(20-9-10-20)19-5-3-2-4-6-19/h7-8,11-12,19-20H,2-6,9-10,13-17H2,1H3 |
| InChIKey | QSEFCCGEEAPVHN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |