C24H32N4O3S — CID 55961564
2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-1-(2-pyridin-4-ylazepan-1-yl)ethanone (PubChem CID 55961564) has the molecular formula C24H32N4O3S and a molecular weight of 456.61 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-1-(2-pyridin-4-ylazepan-1-yl)ethanone.
| Compound Name | 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-1-(2-pyridin-4-ylazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 55961564 |
| Molecular Formula | C24H32N4O3S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-1-(2-pyridin-4-ylazepan-1-yl)ethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CC(=O)N3CCCCCC3c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C24H32N4O3S/c1-20-6-8-22(9-7-20)32(30,31)27-17-15-26(16-18-27)19-24(29)28-14-4-2-3-5-23(28)21-10-12-25-13-11-21/h6-13,23H,2-5,14-19H2,1H3 |
| InChIKey | NXKAGEOAHQYTFR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |