C20H20FNO3 — CID 124731741
7-fluoro-N-[(2R)-2-(hydroxymethyl)-3-(4-methylphenyl)propyl]-1-benzofuran-2-carboxamide (PubChem CID 124731741) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is 7-fluoro-N-[(2R)-2-(hydroxymethyl)-3-(4-methylphenyl)propyl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-fluoro-N-[(2R)-2-(hydroxymethyl)-3-(4-methylphenyl)propyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 124731741 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 7-fluoro-N-[(2R)-2-(hydroxymethyl)-3-(4-methylphenyl)propyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(C[C@@H](CO)CNC(=O)c2cc3cccc(F)c3o2)cc1 |
| InChI | InChI=1S/C20H20FNO3/c1-13-5-7-14(8-6-13)9-15(12-23)11-22-20(24)18-10-16-3-2-4-17(21)19(16)25-18/h2-8,10,15,23H,9,11-12H2,1H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | JDRSAFLNIQMRNX-OAHLLOKOSA-N |
| XLogP | 3.46 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |