C15H16Cl2N2O2 — CID 124732456
2-[[(1R,2R)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]-N-prop-2-ynylacetamide (PubChem CID 124732456) has the molecular formula C15H16Cl2N2O2 and a molecular weight of 327.21 g/mol. Its IUPAC name is 2-[[(1R,2R)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]-N-prop-2-ynylacetamide.
| Compound Name | 2-[[(1R,2R)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 124732456 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-[[(1R,2R)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CN(C)[C@@H]1c2cc(Cl)cc(Cl)c2C[C@H]1O |
| InChI | InChI=1S/C15H16Cl2N2O2/c1-3-4-18-14(21)8-19(2)15-11-5-9(16)6-12(17)10(11)7-13(15)20/h1,5-6,13,15,20H,4,7-8H2,2H3,(H,18,21)/t13-,15-/m1/s1 |
| InChIKey | JOXRNOITLJRPKB-UKRRQHHQSA-N |
| XLogP | 1.63 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|