C14H16Cl2N2O — CID 124802998
4-[[(1S,2R)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]butanenitrile (PubChem CID 124802998) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is 4-[[(1S,2R)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]butanenitrile.
| Compound Name | 4-[[(1S,2R)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]butanenitrile |
|---|---|
| PubChem CID | 124802998 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-[[(1S,2R)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]butanenitrile |
| SMILES | CN(CCCC#N)[C@H]1c2cc(Cl)cc(Cl)c2C[C@H]1O |
| InChI | InChI=1S/C14H16Cl2N2O/c1-18(5-3-2-4-17)14-11-6-9(15)7-12(16)10(11)8-13(14)19/h6-7,13-14,19H,2-3,5,8H2,1H3/t13-,14+/m1/s1 |
| InChIKey | FGQCPQXNILTERB-KGLIPLIRSA-N |
| XLogP | 3.19 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|