C15H21ClN6O2 — CID 124734048
1-[2-(5-chloro-2-ethoxyphenyl)ethyl]-3-[(1R)-1-(1-methyltetrazol-5-yl)ethyl]urea (PubChem CID 124734048) has the molecular formula C15H21ClN6O2 and a molecular weight of 352.83 g/mol. Its IUPAC name is 1-[2-(5-chloro-2-ethoxyphenyl)ethyl]-3-[(1R)-1-(1-methyltetrazol-5-yl)ethyl]urea.
| Compound Name | 1-[2-(5-chloro-2-ethoxyphenyl)ethyl]-3-[(1R)-1-(1-methyltetrazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 124734048 |
| Molecular Formula | C15H21ClN6O2 |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-[2-(5-chloro-2-ethoxyphenyl)ethyl]-3-[(1R)-1-(1-methyltetrazol-5-yl)ethyl]urea |
| SMILES | CCOc1ccc(Cl)cc1CCNC(=O)N[C@H](C)c1nnnn1C |
| InChI | InChI=1S/C15H21ClN6O2/c1-4-24-13-6-5-12(16)9-11(13)7-8-17-15(23)18-10(2)14-19-20-21-22(14)3/h5-6,9-10H,4,7-8H2,1-3H3,(H2,17,18,23)/t10-/m1/s1 |
| InChIKey | LVPUHYBDQGPOOM-SNVBAGLBSA-N |
| XLogP | 1.87 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |