C15H20ClN5O2 — CID 70755136
1-(2-aminoethyl)-N-[(5-chloro-2-ethoxyphenyl)methyl]-N-methyltriazole-4-carboxamide (PubChem CID 70755136) has the molecular formula C15H20ClN5O2 and a molecular weight of 337.81 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-[(5-chloro-2-ethoxyphenyl)methyl]-N-methyltriazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-[(5-chloro-2-ethoxyphenyl)methyl]-N-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 70755136 |
| Molecular Formula | C15H20ClN5O2 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 1-(2-aminoethyl)-N-[(5-chloro-2-ethoxyphenyl)methyl]-N-methyltriazole-4-carboxamide |
| SMILES | CCOc1ccc(Cl)cc1CN(C)C(=O)c1cn(CCN)nn1 |
| InChI | InChI=1S/C15H20ClN5O2/c1-3-23-14-5-4-12(16)8-11(14)9-20(2)15(22)13-10-21(7-6-17)19-18-13/h4-5,8,10H,3,6-7,9,17H2,1-2H3 |
| InChIKey | JNPGKAURJLYGPG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |