C13H25NO3S — CID 124734107
(4aS,8aR)-6-pentylsulfonyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine (PubChem CID 124734107) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is (4aS,8aR)-6-pentylsulfonyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine.
| Compound Name | (4aS,8aR)-6-pentylsulfonyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 124734107 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | (4aS,8aR)-6-pentylsulfonyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine |
| SMILES | CCCCCS(=O)(=O)N1CC[C@H]2OCCC[C@H]2C1 |
| InChI | InChI=1S/C13H25NO3S/c1-2-3-4-10-18(15,16)14-8-7-13-12(11-14)6-5-9-17-13/h12-13H,2-11H2,1H3/t12-,13+/m0/s1 |
| InChIKey | LWHWXDOGSWYPCB-QWHCGFSZSA-N |
| XLogP | 2.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|