C15H19F2NO3S — CID 97331132
(4aR,8aS)-6-[(2,6-difluorophenyl)methylsulfonyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine (PubChem CID 97331132) has the molecular formula C15H19F2NO3S and a molecular weight of 331.38 g/mol. Its IUPAC name is (4aR,8aS)-6-[(2,6-difluorophenyl)methylsulfonyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine.
| Compound Name | (4aR,8aS)-6-[(2,6-difluorophenyl)methylsulfonyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 97331132 |
| Molecular Formula | C15H19F2NO3S |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (4aR,8aS)-6-[(2,6-difluorophenyl)methylsulfonyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine |
| SMILES | O=S(=O)(Cc1c(F)cccc1F)N1CC[C@@H]2OCCC[C@@H]2C1 |
| InChI | InChI=1S/C15H19F2NO3S/c16-13-4-1-5-14(17)12(13)10-22(19,20)18-7-6-15-11(9-18)3-2-8-21-15/h1,4-5,11,15H,2-3,6-10H2/t11-,15+/m1/s1 |
| InChIKey | UMPVOOCWFGWCON-ABAIWWIYSA-N |
| XLogP | 2.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |