C14H29NO3S — CID 124735492
(3R)-1-(2,2-dimethylpropylsulfonyl)-3-(2-methoxyethyl)azepane (PubChem CID 124735492) has the molecular formula C14H29NO3S and a molecular weight of 291.46 g/mol. Its IUPAC name is (3R)-1-(2,2-dimethylpropylsulfonyl)-3-(2-methoxyethyl)azepane.
| Compound Name | (3R)-1-(2,2-dimethylpropylsulfonyl)-3-(2-methoxyethyl)azepane |
|---|---|
| PubChem CID | 124735492 |
| Molecular Formula | C14H29NO3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | (3R)-1-(2,2-dimethylpropylsulfonyl)-3-(2-methoxyethyl)azepane |
| SMILES | COCC[C@H]1CCCCN(S(=O)(=O)CC(C)(C)C)C1 |
| InChI | InChI=1S/C14H29NO3S/c1-14(2,3)12-19(16,17)15-9-6-5-7-13(11-15)8-10-18-4/h13H,5-12H2,1-4H3/t13-/m1/s1 |
| InChIKey | NQMOITQVLGMGHJ-CYBMUJFWSA-N |
| XLogP | 2.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |