C21H20N2O4 — CID 124760155
(E)-3-(1,3-benzodioxol-5-yl)-N-[(2R)-2-hydroxy-2-(1-methylindol-5-yl)ethyl]prop-2-enamide (PubChem CID 124760155) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[(2R)-2-hydroxy-2-(1-methylindol-5-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(2R)-2-hydroxy-2-(1-methylindol-5-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 124760155 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(2R)-2-hydroxy-2-(1-methylindol-5-yl)ethyl]prop-2-enamide |
| SMILES | Cn1ccc2cc([C@@H](O)CNC(=O)/C=C/c3ccc4c(c3)OCO4)ccc21 |
| InChI | InChI=1S/C21H20N2O4/c1-23-9-8-15-11-16(4-5-17(15)23)18(24)12-22-21(25)7-3-14-2-6-19-20(10-14)27-13-26-19/h2-11,18,24H,12-13H2,1H3,(H,22,25)/b7-3+/t18-/m0/s1 |
| InChIKey | JLZCVJGDVFSVIW-JGIVAVPZSA-N |
| XLogP | 2.77 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|