C20H17NO5S — CID 171145415
3-(1,3-benzodioxol-5-yl)-N-[2-[5-(furan-2-yl)thiophen-2-yl]-2-hydroxyethyl]prop-2-enamide (PubChem CID 171145415) has the molecular formula C20H17NO5S and a molecular weight of 383.43 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[2-[5-(furan-2-yl)thiophen-2-yl]-2-hydroxyethyl]prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[2-[5-(furan-2-yl)thiophen-2-yl]-2-hydroxyethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171145415 |
| Molecular Formula | C20H17NO5S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[2-[5-(furan-2-yl)thiophen-2-yl]-2-hydroxyethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)NCC(O)c1ccc(-c2ccco2)s1 |
| InChI | InChI=1S/C20H17NO5S/c22-14(18-6-7-19(27-18)16-2-1-9-24-16)11-21-20(23)8-4-13-3-5-15-17(10-13)26-12-25-15/h1-10,14,22H,11-12H2,(H,21,23) |
| InChIKey | PBJIRNZBPCLKDE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|