C19H21ClN2O2S — CID 124760652
(E)-3-(2-chlorophenyl)-N-[(2R)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]prop-2-enamide (PubChem CID 124760652) has the molecular formula C19H21ClN2O2S and a molecular weight of 376.91 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[(2R)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[(2R)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 124760652 |
| Molecular Formula | C19H21ClN2O2S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[(2R)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)NC[C@H](c1ccco1)N1CCSCC1 |
| InChI | InChI=1S/C19H21ClN2O2S/c20-16-5-2-1-4-15(16)7-8-19(23)21-14-17(18-6-3-11-24-18)22-9-12-25-13-10-22/h1-8,11,17H,9-10,12-14H2,(H,21,23)/b8-7+/t17-/m1/s1 |
| InChIKey | OJBFMGLXGRRFJV-IWAYRVGRSA-N |
| XLogP | 3.85 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|