C30H33N3O4 — CID 124765985
(1R,2S,5R,6S,7R)-2-N-tert-butyl-3-(2,3-dihydro-1H-inden-5-yl)-6-N-(2-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 124765985) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is (1R,2S,5R,6S,7R)-2-N-tert-butyl-3-(2,3-dihydro-1H-inden-5-yl)-6-N-(2-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5R,6S,7R)-2-N-tert-butyl-3-(2,3-dihydro-1H-inden-5-yl)-6-N-(2-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 124765985 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | (1R,2S,5R,6S,7R)-2-N-tert-butyl-3-(2,3-dihydro-1H-inden-5-yl)-6-N-(2-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1ccccc1NC(=O)[C@H]1[C@H]2C(=O)N(c3ccc4c(c3)CCC4)[C@H](C(=O)NC(C)(C)C)[C@@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C30H33N3O4/c1-17-8-5-6-11-21(17)31-26(34)23-22-14-15-30(37-22)24(23)28(36)33(25(30)27(35)32-29(2,3)4)20-13-12-18-9-7-10-19(18)16-20/h5-6,8,11-16,22-25H,7,9-10H2,1-4H3,(H,31,34)(H,32,35)/t22-,23-,24+,25-,30-/m1/s1 |
| InChIKey | PWAVRZVBAYVJOI-IBIWMPTQSA-N |
| XLogP | 3.69 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|