C21H17Cl2NO2S2 — CID 124767234
(1S,2S,9S,10R,11S)-9-[5-(2,5-dichlorophenyl)furan-2-yl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one (PubChem CID 124767234) has the molecular formula C21H17Cl2NO2S2 and a molecular weight of 450.41 g/mol. Its IUPAC name is (1S,2S,9S,10R,11S)-9-[5-(2,5-dichlorophenyl)furan-2-yl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one.
| Compound Name | (1S,2S,9S,10R,11S)-9-[5-(2,5-dichlorophenyl)furan-2-yl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
|---|---|
| PubChem CID | 124767234 |
| Molecular Formula | C21H17Cl2NO2S2 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | (1S,2S,9S,10R,11S)-9-[5-(2,5-dichlorophenyl)furan-2-yl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
| SMILES | O=c1[nH]c2c(s1)[C@H](c1ccc(-c3cc(Cl)ccc3Cl)o1)[C@H]1[C@H]3CC[C@@H](C3)[C@@H]1S2 |
| InChI | InChI=1S/C21H17Cl2NO2S2/c22-11-3-4-13(23)12(8-11)14-5-6-15(26-14)17-16-9-1-2-10(7-9)18(16)27-20-19(17)28-21(25)24-20/h3-6,8-10,16-18H,1-2,7H2,(H,24,25)/t9-,10-,16+,17+,18-/m0/s1 |
| InChIKey | BTCQDSXCVJQHHZ-ZTLNELKESA-N |
| XLogP | 6.66 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|