C21H18N2O4S2 — CID 50903571
(1R,2S,9R,10R,11S)-9-[5-(4-nitrophenyl)furan-2-yl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one (PubChem CID 50903571) has the molecular formula C21H18N2O4S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is (1R,2S,9R,10R,11S)-9-[5-(4-nitrophenyl)furan-2-yl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one.
| Compound Name | (1R,2S,9R,10R,11S)-9-[5-(4-nitrophenyl)furan-2-yl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
|---|---|
| PubChem CID | 50903571 |
| Molecular Formula | C21H18N2O4S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | (1R,2S,9R,10R,11S)-9-[5-(4-nitrophenyl)furan-2-yl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
| SMILES | O=c1[nH]c2c(s1)[C@@H](c1ccc(-c3ccc([N+](=O)[O-])cc3)o1)[C@H]1[C@H]3CC[C@H](C3)[C@@H]1S2 |
| InChI | InChI=1S/C21H18N2O4S2/c24-21-22-20-19(29-21)17(16-11-1-2-12(9-11)18(16)28-20)15-8-7-14(27-15)10-3-5-13(6-4-10)23(25)26/h3-8,11-12,16-18H,1-2,9H2,(H,22,24)/t11-,12+,16+,17-,18-/m0/s1 |
| InChIKey | ZVGLNIAISAECNX-PCWYZGSCSA-N |
| XLogP | 5.26 |
| TPSA | 89.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|