C24H21ClN2O4S2 — CID 98145559
(1R,2R,9R,10R,11R)-9-[2-[(2-chlorophenyl)methoxy]-5-nitrophenyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one (PubChem CID 98145559) has the molecular formula C24H21ClN2O4S2 and a molecular weight of 501.03 g/mol. Its IUPAC name is (1R,2R,9R,10R,11R)-9-[2-[(2-chlorophenyl)methoxy]-5-nitrophenyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one.
| Compound Name | (1R,2R,9R,10R,11R)-9-[2-[(2-chlorophenyl)methoxy]-5-nitrophenyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
|---|---|
| PubChem CID | 98145559 |
| Molecular Formula | C24H21ClN2O4S2 |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | (1R,2R,9R,10R,11R)-9-[2-[(2-chlorophenyl)methoxy]-5-nitrophenyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
| SMILES | O=c1[nH]c2c(s1)[C@@H](c1cc([N+](=O)[O-])ccc1OCc1ccccc1Cl)[C@H]1[C@@H]3CC[C@H](C3)[C@H]1S2 |
| InChI | InChI=1S/C24H21ClN2O4S2/c25-17-4-2-1-3-14(17)11-31-18-8-7-15(27(29)30)10-16(18)20-19-12-5-6-13(9-12)21(19)32-23-22(20)33-24(28)26-23/h1-4,7-8,10,12-13,19-21H,5-6,9,11H2,(H,26,28)/t12-,13-,19-,20+,21-/m1/s1 |
| InChIKey | QOGOWCLXSZOUGF-ZCSMABDTSA-N |
| XLogP | 6.23 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|