C21H18ClNO2S2 — CID 124776199
(1S,2S,9S,10S,11S)-9-[5-(4-chlorophenyl)furan-2-yl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one (PubChem CID 124776199) has the molecular formula C21H18ClNO2S2 and a molecular weight of 415.97 g/mol. Its IUPAC name is (1S,2S,9S,10S,11S)-9-[5-(4-chlorophenyl)furan-2-yl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one.
| Compound Name | (1S,2S,9S,10S,11S)-9-[5-(4-chlorophenyl)furan-2-yl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
|---|---|
| PubChem CID | 124776199 |
| Molecular Formula | C21H18ClNO2S2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | (1S,2S,9S,10S,11S)-9-[5-(4-chlorophenyl)furan-2-yl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
| SMILES | O=c1[nH]c2c(s1)[C@H](c1ccc(-c3ccc(Cl)cc3)o1)[C@@H]1[C@H]3CC[C@@H](C3)[C@@H]1S2 |
| InChI | InChI=1S/C21H18ClNO2S2/c22-13-5-3-10(4-6-13)14-7-8-15(25-14)17-16-11-1-2-12(9-11)18(16)26-20-19(17)27-21(24)23-20/h3-8,11-12,16-18H,1-2,9H2,(H,23,24)/t11-,12-,16-,17+,18-/m0/s1 |
| InChIKey | IFZZJXXZCTYFEB-HMQUYODESA-N |
| XLogP | 6.00 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|