C31H51N3O5 — CID 124768240
3-O-[(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 1-O-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2R,3S,6Z)-6-(carbamoylhydrazinylidene)-2,4-dimethylcyclohex-4-ene-1,3-dicarboxylate (PubChem CID 124768240) has the molecular formula C31H51N3O5 and a molecular weight of 545.77 g/mol. Its IUPAC name is 3-O-[(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 1-O-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2R,3S,6Z)-6-(carbamoylhydrazinylidene)-2,4-dimethylcyclohex-4-ene-1,3-dicarboxylate.
| Compound Name | 3-O-[(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 1-O-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2R,3S,6Z)-6-(carbamoylhydrazinylidene)-2,4-dimethylcyclohex-4-ene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 124768240 |
| Molecular Formula | C31H51N3O5 |
| Molecular Weight | 545.77 g/mol |
| Exact Mass | 545.38 |
| IUPAC Name | 3-O-[(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 1-O-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2R,3S,6Z)-6-(carbamoylhydrazinylidene)-2,4-dimethylcyclohex-4-ene-1,3-dicarboxylate |
| SMILES | CC1=C/C(=N/NC(N)=O)[C@H](C(=O)O[C@@H]2C[C@H](C)CC[C@@H]2C(C)C)[C@H](C)C1C(=O)O[C@@H]1C[C@@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C31H51N3O5/c1-16(2)22-11-9-18(5)13-25(22)38-29(35)27-20(7)15-24(33-34-31(32)37)28(21(27)8)30(36)39-26-14-19(6)10-12-23(26)17(3)4/h15-19,21-23,25-28H,9-14H2,1-8H3,(H3,32,34,37)/b33-24-/t18-,19+,21+,22-,23+,25+,26+,27?,28+/m0/s1 |
| InChIKey | NJXPVAVICLRJJI-CKIDUBSTSA-N |
| XLogP | 5.85 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.77 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|