C16H21FN4O3S — CID 124781124
(4R,4aR,7aR)-N-(cyclopropylmethyl)-6-(5-fluoropyrimidin-2-yl)-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide (PubChem CID 124781124) has the molecular formula C16H21FN4O3S and a molecular weight of 368.43 g/mol. Its IUPAC name is (4R,4aR,7aR)-N-(cyclopropylmethyl)-6-(5-fluoropyrimidin-2-yl)-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide.
| Compound Name | (4R,4aR,7aR)-N-(cyclopropylmethyl)-6-(5-fluoropyrimidin-2-yl)-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 124781124 |
| Molecular Formula | C16H21FN4O3S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (4R,4aR,7aR)-N-(cyclopropylmethyl)-6-(5-fluoropyrimidin-2-yl)-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide |
| SMILES | O=C(NCC1CC1)[C@@H]1CCS(=O)(=O)[C@H]2CN(c3ncc(F)cn3)C[C@@H]12 |
| InChI | InChI=1S/C16H21FN4O3S/c17-11-6-19-16(20-7-11)21-8-13-12(15(22)18-5-10-1-2-10)3-4-25(23,24)14(13)9-21/h6-7,10,12-14H,1-5,8-9H2,(H,18,22)/t12-,13+,14+/m1/s1 |
| InChIKey | ARQVFQDBABZYIA-RDBSUJKOSA-N |
| XLogP | 0.38 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |