C16H24N4O3S — CID 97403877
(4S,4aS,7aS)-6-(5-methylpyrimidin-2-yl)-1,1-dioxo-N-propan-2-yl-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide (PubChem CID 97403877) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is (4S,4aS,7aS)-6-(5-methylpyrimidin-2-yl)-1,1-dioxo-N-propan-2-yl-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide.
| Compound Name | (4S,4aS,7aS)-6-(5-methylpyrimidin-2-yl)-1,1-dioxo-N-propan-2-yl-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 97403877 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (4S,4aS,7aS)-6-(5-methylpyrimidin-2-yl)-1,1-dioxo-N-propan-2-yl-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide |
| SMILES | Cc1cnc(N2C[C@@H]3[C@@H](C(=O)NC(C)C)CCS(=O)(=O)[C@@H]3C2)nc1 |
| InChI | InChI=1S/C16H24N4O3S/c1-10(2)19-15(21)12-4-5-24(22,23)14-9-20(8-13(12)14)16-17-6-11(3)7-18-16/h6-7,10,12-14H,4-5,8-9H2,1-3H3,(H,19,21)/t12-,13+,14+/m0/s1 |
| InChIKey | KGKJFRKSFBPZHM-BFHYXJOUSA-N |
| XLogP | 0.55 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |