C14H19FN4O3S — CID 97403869
(4S,4aS,7aS)-6-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide (PubChem CID 97403869) has the molecular formula C14H19FN4O3S and a molecular weight of 342.40 g/mol. Its IUPAC name is (4S,4aS,7aS)-6-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide.
| Compound Name | (4S,4aS,7aS)-6-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 97403869 |
| Molecular Formula | C14H19FN4O3S |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (4S,4aS,7aS)-6-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CCS(=O)(=O)[C@@H]2CN(c3ncc(F)cn3)C[C@H]12 |
| InChI | InChI=1S/C14H19FN4O3S/c1-18(2)13(20)10-3-4-23(21,22)12-8-19(7-11(10)12)14-16-5-9(15)6-17-14/h5-6,10-12H,3-4,7-8H2,1-2H3/t10-,11+,12+/m0/s1 |
| InChIKey | JGBCRODWNCYYOO-QJPTWQEYSA-N |
| XLogP | -0.06 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |