C14H24N2O4S2 — CID 124783192
[(5aS,8aR)-4-methylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(thian-4-yl)methanone (PubChem CID 124783192) has the molecular formula C14H24N2O4S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is [(5aS,8aR)-4-methylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(thian-4-yl)methanone.
| Compound Name | [(5aS,8aR)-4-methylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(thian-4-yl)methanone |
|---|---|
| PubChem CID | 124783192 |
| Molecular Formula | C14H24N2O4S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [(5aS,8aR)-4-methylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(thian-4-yl)methanone |
| SMILES | CS(=O)(=O)N1CCO[C@H]2CN(C(=O)C3CCSCC3)C[C@H]2C1 |
| InChI | InChI=1S/C14H24N2O4S2/c1-22(18,19)16-4-5-20-13-10-15(8-12(13)9-16)14(17)11-2-6-21-7-3-11/h11-13H,2-10H2,1H3/t12-,13-/m0/s1 |
| InChIKey | MNSAKBDMKHQLMI-STQMWFEESA-N |
| XLogP | 0.25 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |