C21H24O4S — CID 124789666
(1R,2R,3R,4R,7R,10S,11S,12R,13S,14R,15R,18R,21S,22S)-10-methylsulfanyl-8,19-dioxaoctacyclo[10.10.0.02,10.03,7.04,22.011,15.013,21.014,18]docosane-9,20-dione (PubChem CID 124789666) has the molecular formula C21H24O4S and a molecular weight of 372.49 g/mol. Its IUPAC name is (1R,2R,3R,4R,7R,10S,11S,12R,13S,14R,15R,18R,21S,22S)-10-methylsulfanyl-8,19-dioxaoctacyclo[10.10.0.02,10.03,7.04,22.011,15.013,21.014,18]docosane-9,20-dione.
| Compound Name | (1R,2R,3R,4R,7R,10S,11S,12R,13S,14R,15R,18R,21S,22S)-10-methylsulfanyl-8,19-dioxaoctacyclo[10.10.0.02,10.03,7.04,22.011,15.013,21.014,18]docosane-9,20-dione |
|---|---|
| PubChem CID | 124789666 |
| Molecular Formula | C21H24O4S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (1R,2R,3R,4R,7R,10S,11S,12R,13S,14R,15R,18R,21S,22S)-10-methylsulfanyl-8,19-dioxaoctacyclo[10.10.0.02,10.03,7.04,22.011,15.013,21.014,18]docosane-9,20-dione |
| SMILES | CS[C@]12C(=O)O[C@@H]3CC[C@@H]4[C@@H]5[C@@H]6C(=O)O[C@@H]7CC[C@@H]8[C@@H]7[C@@H]6[C@H]([C@@H]5[C@@H]1[C@@H]43)[C@H]82 |
| InChI | InChI=1S/C21H24O4S/c1-26-21-17-7-3-5-8-10(7)13-15(17)14-12(16(13)19(22)24-8)6-2-4-9(25-20(21)23)11(6)18(14)21/h6-18H,2-5H2,1H3/t6-,7+,8+,9+,10-,11-,12-,13+,14+,15+,16-,17-,18-,21-/m0/s1 |
| InChIKey | JDROFKWAZRVEEN-OKTARILQSA-N |
| XLogP | 2.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |