C10H11IO2 — CID 23327737
(1S,2S,3S,4S,7S,8R,9S)-3-iodo-5-oxatetracyclo[5.4.0.02,9.04,8]undecan-6-one (PubChem CID 23327737) has the molecular formula C10H11IO2 and a molecular weight of 290.10 g/mol. Its IUPAC name is (1S,2S,3S,4S,7S,8R,9S)-3-iodo-5-oxatetracyclo[5.4.0.02,9.04,8]undecan-6-one.
| Compound Name | (1S,2S,3S,4S,7S,8R,9S)-3-iodo-5-oxatetracyclo[5.4.0.02,9.04,8]undecan-6-one |
|---|---|
| PubChem CID | 23327737 |
| Molecular Formula | C10H11IO2 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | (1S,2S,3S,4S,7S,8R,9S)-3-iodo-5-oxatetracyclo[5.4.0.02,9.04,8]undecan-6-one |
| SMILES | O=C1O[C@@H]2[C@@H](I)[C@H]3[C@H]4CC[C@H]3[C@H]1[C@@H]42 |
| InChI | InChI=1S/C10H11IO2/c11-8-5-3-1-2-4(5)7-6(3)9(8)13-10(7)12/h3-9H,1-2H2/t3-,4-,5+,6-,7+,8+,9+/m1/s1 |
| InChIKey | AXJLIBVTGUIXGP-TUIIBXMESA-N |
| XLogP | 1.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|