About (1S)-2-methyl-9-propyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one
(1S)-2-methyl-9-propyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 89125087) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is (1S)-2-methyl-9-propyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
Analyze (1S)-2-methyl-9-propyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2-methyl-9-propyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one?
The IUPAC name of (1S)-2-methyl-9-propyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one (CID 89125087) is (1S)-2-methyl-9-propyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
What is the SMILES notation for (1S)-2-methyl-9-propyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one?
The canonical SMILES for (1S)-2-methyl-9-propyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one is CCCC1C2C(=O)OC3C2C[C@@H]1C3C.
What is the InChIKey of (1S)-2-methyl-9-propyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one?
The InChIKey is PPWWUXGCQIUIGG-ICELGVTBSA-N. The full InChI is InChI=1S/C12H18O2/c1-3-4-7-8-5-9-10(7)12(13)14-11(9)6(8)2/h6-11H,3-5H2,1-2H3/t6?,7?,8-,9?,10?,11?/m1/s1.
What are the key properties of (1S)-2-methyl-9-propyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one?
(1S)-2-methyl-9-propyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one has a molecular weight of 194.27 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2-methyl-9-propyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one is sourced from PubChem (CID 89125087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).