C10H11IO4 — CID 11045495
(1S,4S,6R,7S,9S,10R)-9-iodo-3-oxo-2-oxatricyclo[5.2.1.04,10]decane-6-carboxylic acid (PubChem CID 11045495) has the molecular formula C10H11IO4 and a molecular weight of 322.10 g/mol. Its IUPAC name is (1S,4S,6R,7S,9S,10R)-9-iodo-3-oxo-2-oxatricyclo[5.2.1.04,10]decane-6-carboxylic acid.
| Compound Name | (1S,4S,6R,7S,9S,10R)-9-iodo-3-oxo-2-oxatricyclo[5.2.1.04,10]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 11045495 |
| Molecular Formula | C10H11IO4 |
| Molecular Weight | 322.10 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | (1S,4S,6R,7S,9S,10R)-9-iodo-3-oxo-2-oxatricyclo[5.2.1.04,10]decane-6-carboxylic acid |
| SMILES | O=C1O[C@H]2[C@@H]3[C@H](C[C@@H]2I)[C@H](C(=O)O)C[C@H]13 |
| InChI | InChI=1S/C10H11IO4/c11-6-2-3-4(9(12)13)1-5-7(3)8(6)15-10(5)14/h3-8H,1-2H2,(H,12,13)/t3-,4-,5+,6+,7-,8-/m1/s1 |
| InChIKey | NUSJICBXMOZWCZ-YQOPPWPCSA-N |
| XLogP | 1.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.10 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|