C11H11IO2 — CID 100896794
(1S,4S,6R,9R,10S,11R,12S)-12-iodo-2-oxatetracyclo[7.2.1.04,11.06,10]dodec-7-en-3-one (PubChem CID 100896794) has the molecular formula C11H11IO2 and a molecular weight of 302.11 g/mol. Its IUPAC name is (1S,4S,6R,9R,10S,11R,12S)-12-iodo-2-oxatetracyclo[7.2.1.04,11.06,10]dodec-7-en-3-one.
| Compound Name | (1S,4S,6R,9R,10S,11R,12S)-12-iodo-2-oxatetracyclo[7.2.1.04,11.06,10]dodec-7-en-3-one |
|---|---|
| PubChem CID | 100896794 |
| Molecular Formula | C11H11IO2 |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | (1S,4S,6R,9R,10S,11R,12S)-12-iodo-2-oxatetracyclo[7.2.1.04,11.06,10]dodec-7-en-3-one |
| SMILES | O=C1O[C@@H]2[C@@H](I)[C@@H]3C=C[C@H]4C[C@H]1[C@H]2[C@@H]34 |
| InChI | InChI=1S/C11H11IO2/c12-9-5-2-1-4-3-6-8(7(4)5)10(9)14-11(6)13/h1-2,4-10H,3H2/t4-,5+,6-,7+,8-,9-,10-/m0/s1 |
| InChIKey | VRDRMNZLCOLUNO-WHZWFTHESA-N |
| XLogP | 1.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|