C22H32O4 — CID 167247459
(2R)-5,15-diethyl-9,18-dioxapentacyclo[9.9.0.02,8.03,20.012,17]icosane-10,19-dione (PubChem CID 167247459) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (2R)-5,15-diethyl-9,18-dioxapentacyclo[9.9.0.02,8.03,20.012,17]icosane-10,19-dione.
| Compound Name | (2R)-5,15-diethyl-9,18-dioxapentacyclo[9.9.0.02,8.03,20.012,17]icosane-10,19-dione |
|---|---|
| PubChem CID | 167247459 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (2R)-5,15-diethyl-9,18-dioxapentacyclo[9.9.0.02,8.03,20.012,17]icosane-10,19-dione |
| SMILES | CCC1CCC2C(C1)OC(=O)C1C3CC(CC)CCC4OC(=O)C2C1C43 |
| InChI | InChI=1S/C22H32O4/c1-3-11-6-8-15-17-14(9-11)19-20(17)18(21(23)25-15)13-7-5-12(4-2)10-16(13)26-22(19)24/h11-20H,3-10H2,1-2H3 |
| InChIKey | RVPWYVZPENDDHM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |