C13H20 — CID 139995922
4-ethyltricyclo[6.2.1.02,7]undec-9-ene (PubChem CID 139995922) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 4-ethyltricyclo[6.2.1.02,7]undec-9-ene.
| Compound Name | 4-ethyltricyclo[6.2.1.02,7]undec-9-ene |
|---|---|
| PubChem CID | 139995922 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 4-ethyltricyclo[6.2.1.02,7]undec-9-ene |
| SMILES | CCC1CCC2C3C=CC(C3)C2C1 |
| InChI | InChI=1S/C13H20/c1-2-9-3-6-12-10-4-5-11(8-10)13(12)7-9/h4-5,9-13H,2-3,6-8H2,1H3 |
| InChIKey | TYHFZTOWLWNCBJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|