About 4-ethyltricyclo[6.2.1.02,7]undec-9-ene
4-ethyltricyclo[6.2.1.02,7]undec-9-ene (PubChem CID 139995922) has the molecular formula C13H20
and a molecular weight of 176.30 g/mol. Its IUPAC name is 4-ethyltricyclo[6.2.1.02,7]undec-9-ene.
Molecular Properties
| Compound Name | 4-ethyltricyclo[6.2.1.02,7]undec-9-ene |
| PubChem CID | 139995922 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 4-ethyltricyclo[6.2.1.02,7]undec-9-ene |
| SMILES | CCC1CCC2C3C=CC(C3)C2C1 |
| InChI | InChI=1S/C13H20/c1-2-9-3-6-12-10-4-5-11(8-10)13(12)7-9/h4-5,9-13H,2-3,6-8H2,1H3 |
| InChIKey | TYHFZTOWLWNCBJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyltricyclo[6.2.1.02,7]undec-9-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyltricyclo[6.2.1.02,7]undec-9-ene?
The IUPAC name of 4-ethyltricyclo[6.2.1.02,7]undec-9-ene (CID 139995922) is 4-ethyltricyclo[6.2.1.02,7]undec-9-ene.
What is the SMILES notation for 4-ethyltricyclo[6.2.1.02,7]undec-9-ene?
The canonical SMILES for 4-ethyltricyclo[6.2.1.02,7]undec-9-ene is CCC1CCC2C3C=CC(C3)C2C1.
What is the InChIKey of 4-ethyltricyclo[6.2.1.02,7]undec-9-ene?
The InChIKey is TYHFZTOWLWNCBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20/c1-2-9-3-6-12-10-4-5-11(8-10)13(12)7-9/h4-5,9-13H,2-3,6-8H2,1H3.
What are the key properties of 4-ethyltricyclo[6.2.1.02,7]undec-9-ene?
4-ethyltricyclo[6.2.1.02,7]undec-9-ene has a molecular weight of 176.30 g/mol, XLogP of 3.63, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyltricyclo[6.2.1.02,7]undec-9-ene is sourced from PubChem (CID 139995922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).