C12H14N2O2 — CID 124791165
1-hydroxy-2-(4-methoxyphenyl)-4,5-dimethylimidazole (PubChem CID 124791165) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-hydroxy-2-(4-methoxyphenyl)-4,5-dimethylimidazole.
| Compound Name | 1-hydroxy-2-(4-methoxyphenyl)-4,5-dimethylimidazole |
|---|---|
| PubChem CID | 124791165 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-hydroxy-2-(4-methoxyphenyl)-4,5-dimethylimidazole |
| SMILES | COc1ccc(-c2nc(C)c(C)n2O)cc1 |
| InChI | InChI=1S/C12H14N2O2/c1-8-9(2)14(15)12(13-8)10-4-6-11(16-3)7-5-10/h4-7,15H,1-3H3 |
| InChIKey | GEDRVQSMDFOYOD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|