C15H16N2O4 — CID 134109867
[4-(1-acetyloxy-4,5-dimethylimidazol-2-yl)phenyl] acetate (PubChem CID 134109867) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is [4-(1-acetyloxy-4,5-dimethylimidazol-2-yl)phenyl] acetate.
| Compound Name | [4-(1-acetyloxy-4,5-dimethylimidazol-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 134109867 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | [4-(1-acetyloxy-4,5-dimethylimidazol-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2nc(C)c(C)n2OC(C)=O)cc1 |
| InChI | InChI=1S/C15H16N2O4/c1-9-10(2)17(21-12(4)19)15(16-9)13-5-7-14(8-6-13)20-11(3)18/h5-8H,1-4H3 |
| InChIKey | XNTGQDBCTMZNIU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|