C15H18N2O5 — CID 124794045
dimethyl (2R,3S)-2,3-dicyano-2-[(1R)-2-oxocycloheptyl]butanedioate (PubChem CID 124794045) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is dimethyl (2R,3S)-2,3-dicyano-2-[(1R)-2-oxocycloheptyl]butanedioate.
| Compound Name | dimethyl (2R,3S)-2,3-dicyano-2-[(1R)-2-oxocycloheptyl]butanedioate |
|---|---|
| PubChem CID | 124794045 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | dimethyl (2R,3S)-2,3-dicyano-2-[(1R)-2-oxocycloheptyl]butanedioate |
| SMILES | COC(=O)[C@H](C#N)[C@](C#N)(C(=O)OC)[C@H]1CCCCCC1=O |
| InChI | InChI=1S/C15H18N2O5/c1-21-13(19)11(8-16)15(9-17,14(20)22-2)10-6-4-3-5-7-12(10)18/h10-11H,3-7H2,1-2H3/t10-,11-,15+/m0/s1 |
| InChIKey | YXDVCPLEVGUDPU-ZIBATOQPSA-N |
| XLogP | 1.13 |
| TPSA | 117.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |