C16H20N2O5 — CID 97037236
dimethyl (2R,3S)-2,3-dicyano-2-[(1S)-2-oxocyclooctyl]butanedioate (PubChem CID 97037236) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is dimethyl (2R,3S)-2,3-dicyano-2-[(1S)-2-oxocyclooctyl]butanedioate.
| Compound Name | dimethyl (2R,3S)-2,3-dicyano-2-[(1S)-2-oxocyclooctyl]butanedioate |
|---|---|
| PubChem CID | 97037236 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | dimethyl (2R,3S)-2,3-dicyano-2-[(1S)-2-oxocyclooctyl]butanedioate |
| SMILES | COC(=O)[C@H](C#N)[C@](C#N)(C(=O)OC)[C@@H]1CCCCCCC1=O |
| InChI | InChI=1S/C16H20N2O5/c1-22-14(20)12(9-17)16(10-18,15(21)23-2)11-7-5-3-4-6-8-13(11)19/h11-12H,3-8H2,1-2H3/t11-,12+,16-/m1/s1 |
| InChIKey | LHCMXSTVBVFKTQ-BFQNTYOBSA-N |
| XLogP | 1.52 |
| TPSA | 117.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |