C14H16N2O5 — CID 97037227
dimethyl (2R,3R)-2,3-dicyano-2-[(1S)-2-oxocyclohexyl]butanedioate (PubChem CID 97037227) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is dimethyl (2R,3R)-2,3-dicyano-2-[(1S)-2-oxocyclohexyl]butanedioate.
| Compound Name | dimethyl (2R,3R)-2,3-dicyano-2-[(1S)-2-oxocyclohexyl]butanedioate |
|---|---|
| PubChem CID | 97037227 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | dimethyl (2R,3R)-2,3-dicyano-2-[(1S)-2-oxocyclohexyl]butanedioate |
| SMILES | COC(=O)[C@@H](C#N)[C@](C#N)(C(=O)OC)[C@@H]1CCCCC1=O |
| InChI | InChI=1S/C14H16N2O5/c1-20-12(18)10(7-15)14(8-16,13(19)21-2)9-5-3-4-6-11(9)17/h9-10H,3-6H2,1-2H3/t9-,10-,14-/m1/s1 |
| InChIKey | LAFDIWSPDLEKEU-GPCCPHFNSA-N |
| XLogP | 0.74 |
| TPSA | 117.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |