C20H27N3O2 — CID 124802099
(3aS,7aS)-N,N-dimethyl-5-[(1-methylindol-3-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide (PubChem CID 124802099) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is (3aS,7aS)-N,N-dimethyl-5-[(1-methylindol-3-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide.
| Compound Name | (3aS,7aS)-N,N-dimethyl-5-[(1-methylindol-3-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide |
|---|---|
| PubChem CID | 124802099 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (3aS,7aS)-N,N-dimethyl-5-[(1-methylindol-3-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide |
| SMILES | CN(C)C(=O)[C@]12CCO[C@H]1CCN(Cc1cn(C)c3ccccc13)C2 |
| InChI | InChI=1S/C20H27N3O2/c1-21(2)19(24)20-9-11-25-18(20)8-10-23(14-20)13-15-12-22(3)17-7-5-4-6-16(15)17/h4-7,12,18H,8-11,13-14H2,1-3H3/t18-,20-/m0/s1 |
| InChIKey | CPHCLAGYFOFXNT-ICSRJNTNSA-N |
| XLogP | 2.25 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |