C24H34N2 — CID 124805468
(3S,5R)-3,5-dimethyl-N-[(1-propylindol-3-yl)methyl]adamantan-1-amine (PubChem CID 124805468) has the molecular formula C24H34N2 and a molecular weight of 350.55 g/mol. Its IUPAC name is (3S,5R)-3,5-dimethyl-N-[(1-propylindol-3-yl)methyl]adamantan-1-amine.
| Compound Name | (3S,5R)-3,5-dimethyl-N-[(1-propylindol-3-yl)methyl]adamantan-1-amine |
|---|---|
| PubChem CID | 124805468 |
| Molecular Formula | C24H34N2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | (3S,5R)-3,5-dimethyl-N-[(1-propylindol-3-yl)methyl]adamantan-1-amine |
| SMILES | CCCn1cc(CNC23CC4C[C@@](C)(C2)C[C@](C)(C4)C3)c2ccccc21 |
| InChI | InChI=1S/C24H34N2/c1-4-9-26-14-19(20-7-5-6-8-21(20)26)13-25-24-12-18-10-22(2,16-24)15-23(3,11-18)17-24/h5-8,14,18,25H,4,9-13,15-17H2,1-3H3/t18?,22-,23+,24? |
| InChIKey | JJXYSQYFYNBKGR-SYQRVOMBSA-N |
| XLogP | 5.89 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |