C17H21FN4O2S — CID 124810936
(3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 124810936) has the molecular formula C17H21FN4O2S and a molecular weight of 364.45 g/mol. Its IUPAC name is (3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 124810936 |
| Molecular Formula | C17H21FN4O2S |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]ethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | Cc1nc(COCC[C@@H]2CO[C@@H]3CN(c4ncc(F)cn4)C[C@H]23)cs1 |
| InChI | InChI=1S/C17H21FN4O2S/c1-11-21-14(10-25-11)9-23-3-2-12-8-24-16-7-22(6-15(12)16)17-19-4-13(18)5-20-17/h4-5,10,12,15-16H,2-3,6-9H2,1H3/t12-,15-,16-/m1/s1 |
| InChIKey | QMXDCKDHKYGAKU-DAXOMENPSA-N |
| XLogP | 2.44 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|