C18H31N3O2 — CID 124816071
(2S)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-[(2R)-2-methylpiperidin-1-yl]butyl]propanamide (PubChem CID 124816071) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is (2S)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-[(2R)-2-methylpiperidin-1-yl]butyl]propanamide.
| Compound Name | (2S)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-[(2R)-2-methylpiperidin-1-yl]butyl]propanamide |
|---|---|
| PubChem CID | 124816071 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | (2S)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-[(2R)-2-methylpiperidin-1-yl]butyl]propanamide |
| SMILES | Cc1noc(C)c1[C@H](C)C(=O)NCCCCN1CCCC[C@H]1C |
| InChI | InChI=1S/C18H31N3O2/c1-13-9-5-7-11-21(13)12-8-6-10-19-18(22)14(2)17-15(3)20-23-16(17)4/h13-14H,5-12H2,1-4H3,(H,19,22)/t13-,14+/m1/s1 |
| InChIKey | REHZAXUZVBMPGG-KGLIPLIRSA-N |
| XLogP | 3.17 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|