C20H30N4O2 — CID 124819212
2-[(7R)-5-[(3,5-dimethoxyphenyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]-N,N-dimethylethanamine (PubChem CID 124819212) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 2-[(7R)-5-[(3,5-dimethoxyphenyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[(7R)-5-[(3,5-dimethoxyphenyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 124819212 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 2-[(7R)-5-[(3,5-dimethoxyphenyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]-N,N-dimethylethanamine |
| SMILES | COc1cc(CN2Cc3ccnn3C[C@H](CCN(C)C)C2)cc(OC)c1 |
| InChI | InChI=1S/C20H30N4O2/c1-22(2)8-6-16-12-23(15-18-5-7-21-24(18)14-16)13-17-9-19(25-3)11-20(10-17)26-4/h5,7,9-11,16H,6,8,12-15H2,1-4H3/t16-/m1/s1 |
| InChIKey | SXUUODKXWPAMIM-MRXNPFEDSA-N |
| XLogP | 2.48 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |