C36H32N2O3S — CID 124823225
(2'S,3S,3'R,10'bS)-2'-(4-pentylbenzoyl)-3'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one (PubChem CID 124823225) has the molecular formula C36H32N2O3S and a molecular weight of 572.73 g/mol. Its IUPAC name is (2'S,3S,3'R,10'bS)-2'-(4-pentylbenzoyl)-3'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one.
| Compound Name | (2'S,3S,3'R,10'bS)-2'-(4-pentylbenzoyl)-3'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
|---|---|
| PubChem CID | 124823225 |
| Molecular Formula | C36H32N2O3S |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | (2'S,3S,3'R,10'bS)-2'-(4-pentylbenzoyl)-3'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
| SMILES | CCCCCc1ccc(C(=O)[C@@H]2[C@H](C(=O)c3cccs3)N3C=Cc4ccccc4[C@H]3[C@]23C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C36H32N2O3S/c1-2-3-4-10-23-16-18-25(19-17-23)32(39)30-31(33(40)29-15-9-22-42-29)38-21-20-24-11-5-6-12-26(24)34(38)36(30)27-13-7-8-14-28(27)37-35(36)41/h5-9,11-22,30-31,34H,2-4,10H2,1H3,(H,37,41)/t30-,31+,34-,36+/m0/s1 |
| InChIKey | ONYGOYDHSJNGAY-MXMCVKMKSA-N |
| XLogP | 7.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|