C15H28N2O — CID 124823483
(2S,4R,4aS,8aR)-N-[(2S)-butan-2-yl]-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4-carboxamide (PubChem CID 124823483) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is (2S,4R,4aS,8aR)-N-[(2S)-butan-2-yl]-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4-carboxamide.
| Compound Name | (2S,4R,4aS,8aR)-N-[(2S)-butan-2-yl]-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4-carboxamide |
|---|---|
| PubChem CID | 124823483 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | (2S,4R,4aS,8aR)-N-[(2S)-butan-2-yl]-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4-carboxamide |
| SMILES | CC[C@H](C)NC(=O)[C@@H]1C[C@H](C)N[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C15H28N2O/c1-4-10(2)17-15(18)13-9-11(3)16-14-8-6-5-7-12(13)14/h10-14,16H,4-9H2,1-3H3,(H,17,18)/t10-,11-,12-,13+,14+/m0/s1 |
| InChIKey | AWCPYUJDWBZFIX-QSLWVIQJSA-N |
| XLogP | 2.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |