C24H26N4OS — CID 124838131
2-[2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl]acetonitrile (PubChem CID 124838131) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is 2-[2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl]acetonitrile.
| Compound Name | 2-[2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 124838131 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-[2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl]acetonitrile |
| SMILES | N#CCn1c(CN2CC[C@H]3CCCC[C@H]3C2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C24H26N4OS/c25-11-13-28-21(15-27-12-10-17-6-4-5-9-19(17)14-27)26-23-22(24(28)29)20(16-30-23)18-7-2-1-3-8-18/h1-3,7-8,16-17,19H,4-6,9-10,12-15H2/t17-,19+/m1/s1 |
| InChIKey | BKOOOXRYZWWMHD-MJGOQNOKSA-N |
| XLogP | 4.66 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |